C12H16N3O3+ — CID 71628665
N-cyclohexyl-2-(3,6-dioxopyridazin-1-ium-1-yl)acetamide (PubChem CID 71628665) has the molecular formula C12H16N3O3+ and a molecular weight of 250.28 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,6-dioxopyridazin-1-ium-1-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(3,6-dioxopyridazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 71628665 |
| Molecular Formula | C12H16N3O3+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-cyclohexyl-2-(3,6-dioxopyridazin-1-ium-1-yl)acetamide |
| SMILES | O=C1C=CC(=O)[N+](CC(=O)NC2CCCCC2)=N1 |
| InChI | InChI=1S/C12H15N3O3/c16-10-6-7-12(18)15(14-10)8-11(17)13-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2/p+1 |
| InChIKey | OSUWNAUXUHQBJQ-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|