C12H21F3N2O2 — CID 71629089
tert-butyl N-(piperidin-4-ylmethyl)-N-(trifluoromethyl)carbamate (PubChem CID 71629089) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is tert-butyl N-(piperidin-4-ylmethyl)-N-(trifluoromethyl)carbamate.
| Compound Name | tert-butyl N-(piperidin-4-ylmethyl)-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 71629089 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-(piperidin-4-ylmethyl)-N-(trifluoromethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2/c1-11(2,3)19-10(18)17(12(13,14)15)8-9-4-6-16-7-5-9/h9,16H,4-8H2,1-3H3 |
| InChIKey | GNGAHLNOAMTCFQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|