C11H16BrClN2O — CID 71636519
2-bromo-4-[[(3R)-piperidin-3-yl]oxymethyl]pyridine;hydrochloride (PubChem CID 71636519) has the molecular formula C11H16BrClN2O and a molecular weight of 307.62 g/mol. Its IUPAC name is 2-bromo-4-[[(3R)-piperidin-3-yl]oxymethyl]pyridine;hydrochloride.
| Compound Name | 2-bromo-4-[[(3R)-piperidin-3-yl]oxymethyl]pyridine;hydrochloride |
|---|---|
| PubChem CID | 71636519 |
| Molecular Formula | C11H16BrClN2O |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-bromo-4-[[(3R)-piperidin-3-yl]oxymethyl]pyridine;hydrochloride |
| SMILES | Brc1cc(CO[C@@H]2CCCNC2)ccn1.Cl |
| InChI | InChI=1S/C11H15BrN2O.ClH/c12-11-6-9(3-5-14-11)8-15-10-2-1-4-13-7-10;/h3,5-6,10,13H,1-2,4,7-8H2;1H/t10-;/m1./s1 |
| InChIKey | MDCFZGIZGDMWJC-HNCPQSOCSA-N |
| XLogP | 2.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|