C15H21ClN2O2 — CID 71636674
2-(3-piperidin-3-ylpropoxy)-1,3-benzoxazole;hydrochloride (PubChem CID 71636674) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-(3-piperidin-3-ylpropoxy)-1,3-benzoxazole;hydrochloride.
| Compound Name | 2-(3-piperidin-3-ylpropoxy)-1,3-benzoxazole;hydrochloride |
|---|---|
| PubChem CID | 71636674 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(3-piperidin-3-ylpropoxy)-1,3-benzoxazole;hydrochloride |
| SMILES | Cl.c1ccc2oc(OCCCC3CCCNC3)nc2c1 |
| InChI | InChI=1S/C15H20N2O2.ClH/c1-2-8-14-13(7-1)17-15(19-14)18-10-4-6-12-5-3-9-16-11-12;/h1-2,7-8,12,16H,3-6,9-11H2;1H |
| InChIKey | AIHCEQAYPWJJHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|