C16H16ClF3N2OS — CID 7163676
4-chloro-N-[2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]butanamide (PubChem CID 7163676) has the molecular formula C16H16ClF3N2OS and a molecular weight of 376.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]butanamide.
| Compound Name | 4-chloro-N-[2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 7163676 |
| Molecular Formula | C16H16ClF3N2OS |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-chloro-N-[2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl]butanamide |
| SMILES | O=C(CCCCl)NCCc1csc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H16ClF3N2OS/c17-7-2-5-14(23)21-8-6-13-10-24-15(22-13)11-3-1-4-12(9-11)16(18,19)20/h1,3-4,9-10H,2,5-8H2,(H,21,23) |
| InChIKey | TWSVLCZWGSGIRD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|