C13H17N3S — CID 71636815
N-(piperidin-3-ylmethyl)-1,2-benzothiazol-3-amine (PubChem CID 71636815) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-1,2-benzothiazol-3-amine.
| Compound Name | N-(piperidin-3-ylmethyl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 71636815 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-1,2-benzothiazol-3-amine |
| SMILES | c1ccc2c(NCC3CCCNC3)nsc2c1 |
| InChI | InChI=1S/C13H17N3S/c1-2-6-12-11(5-1)13(16-17-12)15-9-10-4-3-7-14-8-10/h1-2,5-6,10,14H,3-4,7-9H2,(H,15,16) |
| InChIKey | OOORGUJNPPQXIG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |