C13H22ClNO2 — CID 71638021
3-[2-[1-(furan-2-yl)ethoxy]ethyl]piperidine;hydrochloride (PubChem CID 71638021) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-[2-[1-(furan-2-yl)ethoxy]ethyl]piperidine;hydrochloride.
| Compound Name | 3-[2-[1-(furan-2-yl)ethoxy]ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 71638021 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[2-[1-(furan-2-yl)ethoxy]ethyl]piperidine;hydrochloride |
| SMILES | CC(OCCC1CCCNC1)c1ccco1.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-11(13-5-3-8-16-13)15-9-6-12-4-2-7-14-10-12;/h3,5,8,11-12,14H,2,4,6-7,9-10H2,1H3;1H |
| InChIKey | NDKQNKLKJFGOML-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |