C9H13ClN2O2S2 — CID 71640431
2-chloro-5-(piperidin-3-ylsulfonylmethyl)-1,3-thiazole (PubChem CID 71640431) has the molecular formula C9H13ClN2O2S2 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-chloro-5-(piperidin-3-ylsulfonylmethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(piperidin-3-ylsulfonylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 71640431 |
| Molecular Formula | C9H13ClN2O2S2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-chloro-5-(piperidin-3-ylsulfonylmethyl)-1,3-thiazole |
| SMILES | O=S(=O)(Cc1cnc(Cl)s1)C1CCCNC1 |
| InChI | InChI=1S/C9H13ClN2O2S2/c10-9-12-4-7(15-9)6-16(13,14)8-2-1-3-11-5-8/h4,8,11H,1-3,5-6H2 |
| InChIKey | KZUPHCBYTXPKGZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |