C11H18N4O2S — CID 71642687
N-methyl-1-(3-methylpyrazin-2-yl)sulfonylpiperidin-3-amine (PubChem CID 71642687) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-methyl-1-(3-methylpyrazin-2-yl)sulfonylpiperidin-3-amine.
| Compound Name | N-methyl-1-(3-methylpyrazin-2-yl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 71642687 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-methyl-1-(3-methylpyrazin-2-yl)sulfonylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2nccnc2C)C1 |
| InChI | InChI=1S/C11H18N4O2S/c1-9-11(14-6-5-13-9)18(16,17)15-7-3-4-10(8-15)12-2/h5-6,10,12H,3-4,7-8H2,1-2H3 |
| InChIKey | NWMYIGLLNAJDIV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |