C14H19ClN4O — CID 71643070
2-(1,4-diazepan-1-yl)-3-methoxyquinoxaline;hydrochloride (PubChem CID 71643070) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-3-methoxyquinoxaline;hydrochloride.
| Compound Name | 2-(1,4-diazepan-1-yl)-3-methoxyquinoxaline;hydrochloride |
|---|---|
| PubChem CID | 71643070 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-3-methoxyquinoxaline;hydrochloride |
| SMILES | COc1nc2ccccc2nc1N1CCCNCC1.Cl |
| InChI | InChI=1S/C14H18N4O.ClH/c1-19-14-13(18-9-4-7-15-8-10-18)16-11-5-2-3-6-12(11)17-14;/h2-3,5-6,15H,4,7-10H2,1H3;1H |
| InChIKey | RIMQPUJKOBQZEQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |