C18H30N4O3 — CID 71648386
tert-butyl 3-[[(3-methoxypyrazin-2-yl)methyl-methylamino]methyl]piperidine-1-carboxylate (PubChem CID 71648386) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 3-[[(3-methoxypyrazin-2-yl)methyl-methylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3-methoxypyrazin-2-yl)methyl-methylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71648386 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | tert-butyl 3-[[(3-methoxypyrazin-2-yl)methyl-methylamino]methyl]piperidine-1-carboxylate |
| SMILES | COc1nccnc1CN(C)CC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H30N4O3/c1-18(2,3)25-17(23)22-10-6-7-14(12-22)11-21(4)13-15-16(24-5)20-9-8-19-15/h8-9,14H,6-7,10-13H2,1-5H3 |
| InChIKey | UUIPUWOWGIBKPY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |