C10H14N3O2S+ — CID 7165044
(2S)-4-(thiophene-2-carbonyl)piperazin-1-ium-2-carboxamide (PubChem CID 7165044) has the molecular formula C10H14N3O2S+ and a molecular weight of 240.31 g/mol. Its IUPAC name is (2S)-4-(thiophene-2-carbonyl)piperazin-1-ium-2-carboxamide.
| Compound Name | (2S)-4-(thiophene-2-carbonyl)piperazin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 7165044 |
| Molecular Formula | C10H14N3O2S+ |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (2S)-4-(thiophene-2-carbonyl)piperazin-1-ium-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CN(C(=O)c2cccs2)CC[NH2+]1 |
| InChI | InChI=1S/C10H13N3O2S/c11-9(14)7-6-13(4-3-12-7)10(15)8-2-1-5-16-8/h1-2,5,7,12H,3-4,6H2,(H2,11,14)/p+1/t7-/m0/s1 |
| InChIKey | LDRDDPLOHBTPOE-ZETCQYMHSA-O |
| XLogP | -1.38 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |