C10H9NO5 — CID 71650965
6,7-dimethoxy-6H-3,1-benzoxazine-2,4-dione (PubChem CID 71650965) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 6,7-dimethoxy-6H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6,7-dimethoxy-6H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 71650965 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 6,7-dimethoxy-6H-3,1-benzoxazine-2,4-dione |
| SMILES | COC1=CC2=NC(=O)OC(=O)C2=CC1OC |
| InChI | InChI=1S/C10H9NO5/c1-14-7-3-5-6(4-8(7)15-2)11-10(13)16-9(5)12/h3-4,7H,1-2H3 |
| InChIKey | KHPDGRXFAYCDAX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|