C9H7NO4 — CID 71303780
6-methoxy-6H-3,1-benzoxazine-2,4-dione (PubChem CID 71303780) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 6-methoxy-6H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-methoxy-6H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 71303780 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 6-methoxy-6H-3,1-benzoxazine-2,4-dione |
| SMILES | COC1C=CC2=NC(=O)OC(=O)C2=C1 |
| InChI | InChI=1S/C9H7NO4/c1-13-5-2-3-7-6(4-5)8(11)14-9(12)10-7/h2-5H,1H3 |
| InChIKey | HSDCGQWJIAFGGS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|