C8H3NO4 — CID 71303766
3,1-benzoxazine-2,4,6-trione (PubChem CID 71303766) has the molecular formula C8H3NO4 and a molecular weight of 177.11 g/mol. Its IUPAC name is 3,1-benzoxazine-2,4,6-trione.
| Compound Name | 3,1-benzoxazine-2,4,6-trione |
|---|---|
| PubChem CID | 71303766 |
| Molecular Formula | C8H3NO4 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 3,1-benzoxazine-2,4,6-trione |
| SMILES | O=C1C=CC2=NC(=O)OC(=O)C2=C1 |
| InChI | InChI=1S/C8H3NO4/c10-4-1-2-6-5(3-4)7(11)13-8(12)9-6/h1-3H |
| InChIKey | UIOOOKIRCAJKML-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|