C8H4BrNO3 — CID 71303704
6-bromo-6H-3,1-benzoxazine-2,4-dione (PubChem CID 71303704) has the molecular formula C8H4BrNO3 and a molecular weight of 242.03 g/mol. Its IUPAC name is 6-bromo-6H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-bromo-6H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 71303704 |
| Molecular Formula | C8H4BrNO3 |
| Molecular Weight | 242.03 g/mol |
| Exact Mass | 240.94 |
| IUPAC Name | 6-bromo-6H-3,1-benzoxazine-2,4-dione |
| SMILES | O=C1N=C2C=CC(Br)C=C2C(=O)O1 |
| InChI | InChI=1S/C8H4BrNO3/c9-4-1-2-6-5(3-4)7(11)13-8(12)10-6/h1-4H |
| InChIKey | XSDUUOGHBNAFEM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.03 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|