C13H18BrNO2 — CID 71651204
(2-bromo-4,5-dimethylphenyl)-tert-butylcarbamic acid (PubChem CID 71651204) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (2-bromo-4,5-dimethylphenyl)-tert-butylcarbamic acid.
| Compound Name | (2-bromo-4,5-dimethylphenyl)-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 71651204 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (2-bromo-4,5-dimethylphenyl)-tert-butylcarbamic acid |
| SMILES | Cc1cc(Br)c(N(C(=O)O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C13H18BrNO2/c1-8-6-10(14)11(7-9(8)2)15(12(16)17)13(3,4)5/h6-7H,1-5H3,(H,16,17) |
| InChIKey | SRAJGOBWELNPBA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |