C27H28O5S — CID 71653349
(2R,4aR,6R,7S,8R,8aR)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 71653349) has the molecular formula C27H28O5S and a molecular weight of 464.58 g/mol. Its IUPAC name is (2R,4aR,6R,7S,8R,8aR)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aR,6R,7S,8R,8aR)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 71653349 |
| Molecular Formula | C27H28O5S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (2R,4aR,6R,7S,8R,8aR)-6-(4-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | Cc1ccc(S[C@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H](OCc3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C27H28O5S/c1-18-12-14-21(15-13-18)33-27-23(28)25(29-16-19-8-4-2-5-9-19)24-22(31-27)17-30-26(32-24)20-10-6-3-7-11-20/h2-15,22-28H,16-17H2,1H3/t22-,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | GCPPRORVHZAYTG-BLQNYSDHSA-N |
| XLogP | 4.87 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |