C41H41N5O2 — CID 71654077
N-[7-[2-(4-nitrophenyl)-4,5-diphenylimidazol-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 71654077) has the molecular formula C41H41N5O2 and a molecular weight of 635.81 g/mol. Its IUPAC name is N-[7-[2-(4-nitrophenyl)-4,5-diphenylimidazol-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[7-[2-(4-nitrophenyl)-4,5-diphenylimidazol-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 71654077 |
| Molecular Formula | C41H41N5O2 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | N-[7-[2-(4-nitrophenyl)-4,5-diphenylimidazol-1-yl]heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2CCCCCCCNc2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C41H41N5O2/c47-46(48)33-26-24-32(25-27-33)41-44-38(30-16-6-4-7-17-30)40(31-18-8-5-9-19-31)45(41)29-15-3-1-2-14-28-42-39-34-20-10-12-22-36(34)43-37-23-13-11-21-35(37)39/h4-10,12,16-20,22,24-27H,1-3,11,13-15,21,23,28-29H2,(H,42,43) |
| InChIKey | SUVANQLPUCYOBU-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|