C16H11BrN6O2S — CID 71654651
N-(4-bromophenyl)-5-[(5-nitroindazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 71654651) has the molecular formula C16H11BrN6O2S and a molecular weight of 431.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-[(5-nitroindazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(4-bromophenyl)-5-[(5-nitroindazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 71654651 |
| Molecular Formula | C16H11BrN6O2S |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | N-(4-bromophenyl)-5-[(5-nitroindazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2c(cnn2Cc2nnc(Nc3ccc(Br)cc3)s2)c1 |
| InChI | InChI=1S/C16H11BrN6O2S/c17-11-1-3-12(4-2-11)19-16-21-20-15(26-16)9-22-14-6-5-13(23(24)25)7-10(14)8-18-22/h1-8H,9H2,(H,19,21) |
| InChIKey | PHHVQQKZCNAKCU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|