C24H38N2O2 — CID 71654694
(4aS,5R,10bS)-5-(1-ethylpiperidin-4-yl)-9-(3-methylbutoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71654694) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(1-ethylpiperidin-4-yl)-9-(3-methylbutoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-(1-ethylpiperidin-4-yl)-9-(3-methylbutoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71654694 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (4aS,5R,10bS)-5-(1-ethylpiperidin-4-yl)-9-(3-methylbutoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCN1CCC([C@H]2Nc3ccc(OCCC(C)C)cc3[C@H]3OCCC[C@H]32)CC1 |
| InChI | InChI=1S/C24H38N2O2/c1-4-26-12-9-18(10-13-26)23-20-6-5-14-28-24(20)21-16-19(7-8-22(21)25-23)27-15-11-17(2)3/h7-8,16-18,20,23-25H,4-6,9-15H2,1-3H3/t20-,23+,24-/m0/s1 |
| InChIKey | MPMRTTKWHVOKFG-ZTCOLXNVSA-N |
| XLogP | 5.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|