C22H26N4O2S — CID 71654755
1-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 71654755) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 71654755 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[6-(2-ethylphenyl)-1,3-benzothiazol-2-yl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | CCc1ccccc1-c1ccc2nc(NC(=O)NCCN3CCOCC3)sc2c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-2-16-5-3-4-6-18(16)17-7-8-19-20(15-17)29-22(24-19)25-21(27)23-9-10-26-11-13-28-14-12-26/h3-8,15H,2,9-14H2,1H3,(H2,23,24,25,27) |
| InChIKey | ONIXTHIEXURSCP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |