C24H29NO2 — CID 71655349
(4aS,5R,10bS)-5-cyclohexyl-9-phenoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71655349) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclohexyl-9-phenoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-cyclohexyl-9-phenoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655349 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclohexyl-9-phenoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | c1ccc(Oc2ccc3c(c2)[C@H]2OCCC[C@H]2[C@@H](C2CCCCC2)N3)cc1 |
| InChI | InChI=1S/C24H29NO2/c1-3-8-17(9-4-1)23-20-12-7-15-26-24(20)21-16-19(13-14-22(21)25-23)27-18-10-5-2-6-11-18/h2,5-6,10-11,13-14,16-17,20,23-25H,1,3-4,7-9,12,15H2/t20-,23+,24-/m0/s1 |
| InChIKey | VCIAHHQMJRBLID-ZTCOLXNVSA-N |
| XLogP | 6.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |