C13H18O5Si — CID 71658314
dimethyl 3-hydroxy-6-trimethylsilylbenzene-1,2-dicarboxylate (PubChem CID 71658314) has the molecular formula C13H18O5Si and a molecular weight of 282.37 g/mol. Its IUPAC name is dimethyl 3-hydroxy-6-trimethylsilylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-hydroxy-6-trimethylsilylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71658314 |
| Molecular Formula | C13H18O5Si |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | dimethyl 3-hydroxy-6-trimethylsilylbenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(O)ccc([Si](C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C13H18O5Si/c1-17-12(15)10-8(14)6-7-9(19(3,4)5)11(10)13(16)18-2/h6-7,14H,1-5H3 |
| InChIKey | JWGXRXGJQANJGZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|