C12H15NOS3 — CID 716587
N-(2-ethylphenyl)-1,3,5-trithiane-2-carboxamide (PubChem CID 716587) has the molecular formula C12H15NOS3 and a molecular weight of 285.46 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1,3,5-trithiane-2-carboxamide.
| Compound Name | N-(2-ethylphenyl)-1,3,5-trithiane-2-carboxamide |
|---|---|
| PubChem CID | 716587 |
| Molecular Formula | C12H15NOS3 |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(2-ethylphenyl)-1,3,5-trithiane-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1SCSCS1 |
| InChI | InChI=1S/C12H15NOS3/c1-2-9-5-3-4-6-10(9)13-11(14)12-16-7-15-8-17-12/h3-6,12H,2,7-8H2,1H3,(H,13,14) |
| InChIKey | IABPEVNDKPPJKD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |