C10H10BrNOS3 — CID 716608
N-(4-bromophenyl)-1,3,5-trithiane-2-carboxamide (PubChem CID 716608) has the molecular formula C10H10BrNOS3 and a molecular weight of 336.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,3,5-trithiane-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-1,3,5-trithiane-2-carboxamide |
|---|---|
| PubChem CID | 716608 |
| Molecular Formula | C10H10BrNOS3 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 334.91 |
| IUPAC Name | N-(4-bromophenyl)-1,3,5-trithiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1SCSCS1 |
| InChI | InChI=1S/C10H10BrNOS3/c11-7-1-3-8(4-2-7)12-9(13)10-15-5-14-6-16-10/h1-4,10H,5-6H2,(H,12,13) |
| InChIKey | WBRXKWVNIVAVJR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |