C32H34Cl2FN5O3 — CID 71660970
tert-butyl 4-[4-[6-anilino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 71660970) has the molecular formula C32H34Cl2FN5O3 and a molecular weight of 626.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[6-anilino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[6-anilino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71660970 |
| Molecular Formula | C32H34Cl2FN5O3 |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | tert-butyl 4-[4-[6-anilino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)cnc1Nc1ccccc1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C32H34Cl2FN5O3/c1-20(28-25(33)10-11-26(35)29(28)34)42-27-16-21(17-36-30(27)38-23-8-6-5-7-9-23)22-18-37-40(19-22)24-12-14-39(15-13-24)31(41)43-32(2,3)4/h5-11,16-20,24H,12-15H2,1-4H3,(H,36,38)/t20-/m1/s1 |
| InChIKey | JCFXBFDBRPKAKV-HXUWFJFHSA-N |
| XLogP | 8.85 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|