C26H30Cl2FN5O4 — CID 90419306
tert-butyl 4-[4-[5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1-hydroxy-6-imino-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 90419306) has the molecular formula C26H30Cl2FN5O4 and a molecular weight of 566.46 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1-hydroxy-6-imino-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1-hydroxy-6-imino-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90419306 |
| Molecular Formula | C26H30Cl2FN5O4 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | tert-butyl 4-[4-[5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1-hydroxy-6-imino-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | [H]/N=c1/c(OC(C)c2c(Cl)ccc(F)c2Cl)cc(-c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)cn1O |
| InChI | InChI=1S/C26H30Cl2FN5O4/c1-15(22-19(27)5-6-20(29)23(22)28)37-21-11-16(14-34(36)24(21)30)17-12-31-33(13-17)18-7-9-32(10-8-18)25(35)38-26(2,3)4/h5-6,11-15,18,30,36H,7-10H2,1-4H3/b30-24- |
| InChIKey | YNBSGGMSBGGWGS-KRUMMXJUSA-N |
| XLogP | 6.23 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|