C26H30Cl2FN5O2 — CID 123975772
1-[4-[4-[4-amino-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-(ethylamino)ethanone (PubChem CID 123975772) has the molecular formula C26H30Cl2FN5O2 and a molecular weight of 534.46 g/mol. Its IUPAC name is 1-[4-[4-[4-amino-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-(ethylamino)ethanone.
| Compound Name | 1-[4-[4-[4-amino-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 123975772 |
| Molecular Formula | C26H30Cl2FN5O2 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 1-[4-[4-[4-amino-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-(ethylamino)ethanone |
| SMILES | CCNCC(=O)N1CCC(n2cc(-c3ccc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cn2)CC1 |
| InChI | InChI=1S/C26H30Cl2FN5O2/c1-3-31-14-24(35)33-10-8-19(9-11-33)34-15-18(13-32-34)17-4-7-22(30)23(12-17)36-16(2)25-20(27)5-6-21(29)26(25)28/h4-7,12-13,15-16,19,31H,3,8-11,14,30H2,1-2H3 |
| InChIKey | LXZDCZQLDQYLKQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|