C29H29Cl2FN6O2 — CID 144712980
(2R)-2-amino-1-[4-[4-[4-amino-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 144712980) has the molecular formula C29H29Cl2FN6O2 and a molecular weight of 583.50 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-[4-[4-amino-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | (2R)-2-amino-1-[4-[4-[4-amino-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 144712980 |
| Molecular Formula | C29H29Cl2FN6O2 |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | (2R)-2-amino-1-[4-[4-[4-amino-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]phenyl]pyrazol-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCN(C(=O)[C@H](N)c4cccnc4)CC3)c2)ccc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C29H29Cl2FN6O2/c1-17(26-22(30)5-6-23(32)27(26)31)40-25-13-18(4-7-24(25)33)20-15-36-38(16-20)21-8-11-37(12-9-21)29(39)28(34)19-3-2-10-35-14-19/h2-7,10,13-17,21,28H,8-9,11-12,33-34H2,1H3/t17-,28-/m1/s1 |
| InChIKey | KEUYENVTWXVGNR-JYRCXFKTSA-N |
| XLogP | 5.98 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|