C13H10N2O4S3 — CID 71661524
N-[2-hydroxy-4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 71661524) has the molecular formula C13H10N2O4S3 and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-hydroxy-4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-hydroxy-4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71661524 |
| Molecular Formula | C13H10N2O4S3 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-[2-hydroxy-4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=c1[nH]c(-c2ccc(NS(=O)(=O)c3cccs3)c(O)c2)cs1 |
| InChI | InChI=1S/C13H10N2O4S3/c16-11-6-8(10-7-21-13(17)14-10)3-4-9(11)15-22(18,19)12-2-1-5-20-12/h1-7,15-16H,(H,14,17) |
| InChIKey | IRHWTKUUHQJNEM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|