C14H11N3O3S2 — CID 110868467
N-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)thiophene-2-sulfonamide (PubChem CID 110868467) has the molecular formula C14H11N3O3S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110868467 |
| Molecular Formula | C14H11N3O3S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)thiophene-2-sulfonamide |
| SMILES | O=c1[nH]cc(-c2ccncc2)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H11N3O3S2/c18-14-12(17-22(19,20)13-2-1-7-21-13)8-11(9-16-14)10-3-5-15-6-4-10/h1-9,17H,(H,16,18) |
| InChIKey | ZOHUFDXHUDLNPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |