C26H28INO6S — CID 71661739
dimethyl 4-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenyl-2H-pyridine-5,6-dicarboxylate (PubChem CID 71661739) has the molecular formula C26H28INO6S and a molecular weight of 609.48 g/mol. Its IUPAC name is dimethyl 4-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenyl-2H-pyridine-5,6-dicarboxylate.
| Compound Name | dimethyl 4-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenyl-2H-pyridine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 71661739 |
| Molecular Formula | C26H28INO6S |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | dimethyl 4-butyl-3-iodo-1-(4-methylphenyl)sulfonyl-2-phenyl-2H-pyridine-5,6-dicarboxylate |
| SMILES | CCCCC1=C(I)C(c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C26H28INO6S/c1-5-6-12-20-21(25(29)33-3)24(26(30)34-4)28(23(22(20)27)18-10-8-7-9-11-18)35(31,32)19-15-13-17(2)14-16-19/h7-11,13-16,23H,5-6,12H2,1-4H3 |
| InChIKey | LYQLJTOPEMDPLW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|