C23H25FN2 — CID 71661923
N-[(4-tert-butylphenyl)-(4-fluorophenyl)methyl]-3-methylpyridin-2-amine (PubChem CID 71661923) has the molecular formula C23H25FN2 and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)-(4-fluorophenyl)methyl]-3-methylpyridin-2-amine.
| Compound Name | N-[(4-tert-butylphenyl)-(4-fluorophenyl)methyl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 71661923 |
| Molecular Formula | C23H25FN2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[(4-tert-butylphenyl)-(4-fluorophenyl)methyl]-3-methylpyridin-2-amine |
| SMILES | Cc1cccnc1NC(c1ccc(F)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H25FN2/c1-16-6-5-15-25-22(16)26-21(18-9-13-20(24)14-10-18)17-7-11-19(12-8-17)23(2,3)4/h5-15,21H,1-4H3,(H,25,26) |
| InChIKey | RWZARBHVBBGUKJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |