C19H28O2 — CID 71663051
(5S,6S,11Z)-1,6-dimethyl-4-propan-2-yl-7,8,9,10-tetrahydro-5H-benzo[10]annulene-5,6-diol (PubChem CID 71663051) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (5S,6S,11Z)-1,6-dimethyl-4-propan-2-yl-7,8,9,10-tetrahydro-5H-benzo[10]annulene-5,6-diol.
| Compound Name | (5S,6S,11Z)-1,6-dimethyl-4-propan-2-yl-7,8,9,10-tetrahydro-5H-benzo[10]annulene-5,6-diol |
|---|---|
| PubChem CID | 71663051 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (5S,6S,11Z)-1,6-dimethyl-4-propan-2-yl-7,8,9,10-tetrahydro-5H-benzo[10]annulene-5,6-diol |
| SMILES | Cc1ccc(C(C)C)c2c1/C=C\CCCC[C@](C)(O)[C@H]2O |
| InChI | InChI=1S/C19H28O2/c1-13(2)15-11-10-14(3)16-9-7-5-6-8-12-19(4,21)18(20)17(15)16/h7,9-11,13,18,20-21H,5-6,8,12H2,1-4H3/b9-7-/t18-,19-/m0/s1 |
| InChIKey | KXOBEXSEIOGAQO-BDNAOYLZSA-N |
| XLogP | 4.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |