C15H22O2 — CID 10059931
(1R,2R,3R)-3,8-dimethyl-5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-diol (PubChem CID 10059931) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,2R,3R)-3,8-dimethyl-5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-diol.
| Compound Name | (1R,2R,3R)-3,8-dimethyl-5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 10059931 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,2R,3R)-3,8-dimethyl-5-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-diol |
| SMILES | Cc1ccc(C(C)C)c2c1[C@@H](O)[C@H](O)[C@H](C)C2 |
| InChI | InChI=1S/C15H22O2/c1-8(2)11-6-5-9(3)13-12(11)7-10(4)14(16)15(13)17/h5-6,8,10,14-17H,7H2,1-4H3/t10-,14-,15-/m1/s1 |
| InChIKey | OEBHZESREHLVQJ-VCTAVGKDSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |