C11H20O2 — CID 71663609
(4S,6S)-5,5-dimethylnona-1,8-diene-4,6-diol (PubChem CID 71663609) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4S,6S)-5,5-dimethylnona-1,8-diene-4,6-diol.
| Compound Name | (4S,6S)-5,5-dimethylnona-1,8-diene-4,6-diol |
|---|---|
| PubChem CID | 71663609 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4S,6S)-5,5-dimethylnona-1,8-diene-4,6-diol |
| SMILES | C=CC[C@H](O)C(C)(C)[C@@H](O)CC=C |
| InChI | InChI=1S/C11H20O2/c1-5-7-9(12)11(3,4)10(13)8-6-2/h5-6,9-10,12-13H,1-2,7-8H2,3-4H3/t9-,10-/m0/s1 |
| InChIKey | QLRPWSGFPOVURF-UWVGGRQHSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|