C24H31N3O6 — CID 71663965
(2R,3R)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-2-(methylaminomethyl)-10-nitro-3,4-dihydro-2H-1,5-benzoxazocin-6-one (PubChem CID 71663965) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2R,3R)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-2-(methylaminomethyl)-10-nitro-3,4-dihydro-2H-1,5-benzoxazocin-6-one.
| Compound Name | (2R,3R)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-2-(methylaminomethyl)-10-nitro-3,4-dihydro-2H-1,5-benzoxazocin-6-one |
|---|---|
| PubChem CID | 71663965 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2R,3R)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-2-(methylaminomethyl)-10-nitro-3,4-dihydro-2H-1,5-benzoxazocin-6-one |
| SMILES | CNC[C@@H]1Oc2c(cccc2[N+](=O)[O-])C(=O)N([C@@H](C)COCc2ccc(OC)cc2)C[C@H]1C |
| InChI | InChI=1S/C24H31N3O6/c1-16-13-26(17(2)14-32-15-18-8-10-19(31-4)11-9-18)24(28)20-6-5-7-21(27(29)30)23(20)33-22(16)12-25-3/h5-11,16-17,22,25H,12-15H2,1-4H3/t16-,17+,22+/m1/s1 |
| InChIKey | XSQTYXWHDRECDW-JLHGSKIFSA-N |
| XLogP | 3.27 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|