About 5-methylundeca-3,4-dien-1-ol
5-methylundeca-3,4-dien-1-ol (PubChem CID 71664600) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 5-methylundeca-3,4-dien-1-ol.
Molecular Properties
| Compound Name | 5-methylundeca-3,4-dien-1-ol |
| PubChem CID | 71664600 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 5-methylundeca-3,4-dien-1-ol |
| SMILES | CCCCCCC(C)=C=CCCO |
| InChI | InChI=1S/C12H22O/c1-3-4-5-6-9-12(2)10-7-8-11-13/h7,13H,3-6,8-9,11H2,1-2H3 |
| InChIKey | DXPYQCGMQQCOKS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methylundeca-3,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylundeca-3,4-dien-1-ol?
The IUPAC name of 5-methylundeca-3,4-dien-1-ol (CID 71664600) is 5-methylundeca-3,4-dien-1-ol.
What is the SMILES notation for 5-methylundeca-3,4-dien-1-ol?
The canonical SMILES for 5-methylundeca-3,4-dien-1-ol is CCCCCCC(C)=C=CCCO.
What is the InChIKey of 5-methylundeca-3,4-dien-1-ol?
The InChIKey is DXPYQCGMQQCOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-3-4-5-6-9-12(2)10-7-8-11-13/h7,13H,3-6,8-9,11H2,1-2H3.
What are the key properties of 5-methylundeca-3,4-dien-1-ol?
5-methylundeca-3,4-dien-1-ol has a molecular weight of 182.31 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylundeca-3,4-dien-1-ol is sourced from PubChem (CID 71664600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).