C12H14F3NO2 — CID 71668430
(NZ)-N-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]hydroxylamine (PubChem CID 71668430) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is (NZ)-N-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 71668430 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (NZ)-N-[2,2,2-trifluoro-1-(2-methoxy-3-propan-2-ylphenyl)ethylidene]hydroxylamine |
| SMILES | COc1c(/C(=N/O)C(F)(F)F)cccc1C(C)C |
| InChI | InChI=1S/C12H14F3NO2/c1-7(2)8-5-4-6-9(10(8)18-3)11(16-17)12(13,14)15/h4-7,17H,1-3H3/b16-11- |
| InChIKey | TWWCNCUPMPHSKC-WJDWOHSUSA-N |
| XLogP | 3.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|