C18H20N2O5S — CID 7167065
methyl N-[2-[(3-butoxybenzoyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 7167065) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl N-[2-[(3-butoxybenzoyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | methyl N-[2-[(3-butoxybenzoyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167065 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl N-[2-[(3-butoxybenzoyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCCCOc1cccc(C(=O)Nc2sccc2C(=O)NC(=O)OC)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-3-4-9-25-13-7-5-6-12(11-13)15(21)19-17-14(8-10-26-17)16(22)20-18(23)24-2/h5-8,10-11H,3-4,9H2,1-2H3,(H,19,21)(H,20,22,23) |
| InChIKey | YLSIZXOQBZOASN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|