C17H12N2O6S — CID 7167067
methyl N-[2-[(4-oxochromene-3-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 7167067) has the molecular formula C17H12N2O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is methyl N-[2-[(4-oxochromene-3-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | methyl N-[2-[(4-oxochromene-3-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167067 |
| Molecular Formula | C17H12N2O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | methyl N-[2-[(4-oxochromene-3-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | COC(=O)NC(=O)c1ccsc1NC(=O)c1coc2ccccc2c1=O |
| InChI | InChI=1S/C17H12N2O6S/c1-24-17(23)19-14(21)10-6-7-26-16(10)18-15(22)11-8-25-12-5-3-2-4-9(12)13(11)20/h2-8H,1H3,(H,18,22)(H,19,21,23) |
| InChIKey | ONXZIWJOOLWMAC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |