C9H6FNS2 — CID 716719
4-(4-fluorophenyl)-3H-1,3-thiazole-2-thione (PubChem CID 716719) has the molecular formula C9H6FNS2 and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(4-fluorophenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 716719 |
| Molecular Formula | C9H6FNS2 |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 4-(4-fluorophenyl)-3H-1,3-thiazole-2-thione |
| SMILES | Fc1ccc(-c2csc(=S)[nH]2)cc1 |
| InChI | InChI=1S/C9H6FNS2/c10-7-3-1-6(2-4-7)8-5-13-9(12)11-8/h1-5H,(H,11,12) |
| InChIKey | MWMWTZPSWBGHNI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|