C10H7BrF6N2O — CID 71672126
1-(2-bromophenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 71672126) has the molecular formula C10H7BrF6N2O and a molecular weight of 365.07 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 71672126 |
| Molecular Formula | C10H7BrF6N2O |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-(2-bromophenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | O=C(Nc1ccccc1Br)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7BrF6N2O/c11-5-3-1-2-4-6(5)18-8(20)19-7(9(12,13)14)10(15,16)17/h1-4,7H,(H2,18,19,20) |
| InChIKey | NGYHNDFFNLYEPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |