C20H23NO5 — CID 71678336
methyl (1R,4aS,7aS)-1-methoxy-7-[[(2-methylbenzoyl)amino]methyl]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 71678336) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-1-methoxy-7-[[(2-methylbenzoyl)amino]methyl]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-1-methoxy-7-[[(2-methylbenzoyl)amino]methyl]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 71678336 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl (1R,4aS,7aS)-1-methoxy-7-[[(2-methylbenzoyl)amino]methyl]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC)[C@@H]2C(CNC(=O)c3ccccc3C)=CC[C@H]12 |
| InChI | InChI=1S/C20H23NO5/c1-12-6-4-5-7-14(12)18(22)21-10-13-8-9-15-16(19(23)24-2)11-26-20(25-3)17(13)15/h4-8,11,15,17,20H,9-10H2,1-3H3,(H,21,22)/t15-,17-,20-/m1/s1 |
| InChIKey | MFPIIQQHUYZOAS-WRWLIDTKSA-N |
| XLogP | 2.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|