C25H24FNO5 — CID 71679840
methyl (1R,4aS,7aS)-7-[[(3-fluorobenzoyl)amino]methyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 71679840) has the molecular formula C25H24FNO5 and a molecular weight of 437.47 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-7-[[(3-fluorobenzoyl)amino]methyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-7-[[(3-fluorobenzoyl)amino]methyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 71679840 |
| Molecular Formula | C25H24FNO5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | methyl (1R,4aS,7aS)-7-[[(3-fluorobenzoyl)amino]methyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OCc2ccccc2)[C@@H]2C(CNC(=O)c3cccc(F)c3)=CC[C@H]12 |
| InChI | InChI=1S/C25H24FNO5/c1-30-24(29)21-15-32-25(31-14-16-6-3-2-4-7-16)22-18(10-11-20(21)22)13-27-23(28)17-8-5-9-19(26)12-17/h2-10,12,15,20,22,25H,11,13-14H2,1H3,(H,27,28)/t20-,22-,25-/m1/s1 |
| InChIKey | ZHNJLNDZMVMTFL-QFZWGZQFSA-N |
| XLogP | 3.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|