C25H22Cl2O6 — CID 71679183
methyl (1R,4aS,7aS)-7-[(2,3-dichlorobenzoyl)oxymethyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 71679183) has the molecular formula C25H22Cl2O6 and a molecular weight of 489.35 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-7-[(2,3-dichlorobenzoyl)oxymethyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-7-[(2,3-dichlorobenzoyl)oxymethyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 71679183 |
| Molecular Formula | C25H22Cl2O6 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | methyl (1R,4aS,7aS)-7-[(2,3-dichlorobenzoyl)oxymethyl]-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OCc2ccccc2)[C@@H]2C(COC(=O)c3cccc(Cl)c3Cl)=CC[C@H]12 |
| InChI | InChI=1S/C25H22Cl2O6/c1-30-23(28)19-14-33-25(32-12-15-6-3-2-4-7-15)21-16(10-11-17(19)21)13-31-24(29)18-8-5-9-20(26)22(18)27/h2-10,14,17,21,25H,11-13H2,1H3/t17-,21-,25-/m1/s1 |
| InChIKey | DKIYRAWMMXQJKN-IUBQTAPSSA-N |
| XLogP | 5.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|