C19H21NO5 — CID 142634069
methyl (1R,4aS,7aS)-7-(methoxyiminomethyl)-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 142634069) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (1R,4aS,7aS)-7-(methoxyiminomethyl)-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,7aS)-7-(methoxyiminomethyl)-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 142634069 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl (1R,4aS,7aS)-7-(methoxyiminomethyl)-1-phenylmethoxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CON=CC1=CC[C@@H]2C(C(=O)OC)=CO[C@@H](OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C19H21NO5/c1-22-18(21)16-12-25-19(24-11-13-6-4-3-5-7-13)17-14(10-20-23-2)8-9-15(16)17/h3-8,10,12,15,17,19H,9,11H2,1-2H3/t15-,17-,19-/m1/s1 |
| InChIKey | ZTVRFLPOGSFISQ-SZVBFZGTSA-N |
| XLogP | 2.81 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|