About N-phenylbenzamide
N-phenylbenzamide (PubChem CID 7168) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is N-phenylbenzamide.
Molecular Properties
| Compound Name | N-phenylbenzamide |
| PubChem CID | 7168 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11NO/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h1-10H,(H,14,15) |
| InChIKey | ZVSKZLHKADLHSD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylbenzamide?
The IUPAC name of N-phenylbenzamide (CID 7168) is N-phenylbenzamide.
What is the SMILES notation for N-phenylbenzamide?
The canonical SMILES for N-phenylbenzamide is O=C(Nc1ccccc1)c1ccccc1.
What is the InChIKey of N-phenylbenzamide?
The InChIKey is ZVSKZLHKADLHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h1-10H,(H,14,15).
What are the key properties of N-phenylbenzamide?
N-phenylbenzamide has a molecular weight of 197.24 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylbenzamide is sourced from PubChem (CID 7168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).