C17H14FN3O2 — CID 71680127
ethyl 8-amino-2-(3-fluorophenyl)-1,7-naphthyridine-5-carboxylate (PubChem CID 71680127) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is ethyl 8-amino-2-(3-fluorophenyl)-1,7-naphthyridine-5-carboxylate.
| Compound Name | ethyl 8-amino-2-(3-fluorophenyl)-1,7-naphthyridine-5-carboxylate |
|---|---|
| PubChem CID | 71680127 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | ethyl 8-amino-2-(3-fluorophenyl)-1,7-naphthyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N)c2nc(-c3cccc(F)c3)ccc12 |
| InChI | InChI=1S/C17H14FN3O2/c1-2-23-17(22)13-9-20-16(19)15-12(13)6-7-14(21-15)10-4-3-5-11(18)8-10/h3-9H,2H2,1H3,(H2,19,20) |
| InChIKey | QIKOZJAXUAVSCS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |